C20H17IN2O5S2 — CID 126356315
(5E)-5-[(3-iodo-5-methoxy-4-propoxyphenyl)methylidene]-3-(4-nitrophenyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126356315) has the molecular formula C20H17IN2O5S2 and a molecular weight of 556.40 g/mol. Its IUPAC name is (5E)-5-[(3-iodo-5-methoxy-4-propoxyphenyl)methylidene]-3-(4-nitrophenyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(3-iodo-5-methoxy-4-propoxyphenyl)methylidene]-3-(4-nitrophenyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126356315 |
| Molecular Formula | C20H17IN2O5S2 |
| Molecular Weight | 556.40 g/mol |
| Exact Mass | 555.96 |
| IUPAC Name | (5E)-5-[(3-iodo-5-methoxy-4-propoxyphenyl)methylidene]-3-(4-nitrophenyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCCOc1c(I)cc(/C=C2/SC(=S)N(c3ccc([N+](=O)[O-])cc3)C2=O)cc1OC |
| InChI | InChI=1S/C20H17IN2O5S2/c1-3-8-28-18-15(21)9-12(10-16(18)27-2)11-17-19(24)22(20(29)30-17)13-4-6-14(7-5-13)23(25)26/h4-7,9-11H,3,8H2,1-2H3/b17-11+ |
| InChIKey | YJFAKMINKPUULY-GZTJUZNOSA-N |
| XLogP | 5.40 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.40 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|