C18H12I2N2O4S2 — CID 126345530
(5Z)-5-[(2-ethoxy-3,5-diiodophenyl)methylidene]-3-(4-nitrophenyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126345530) has the molecular formula C18H12I2N2O4S2 and a molecular weight of 638.25 g/mol. Its IUPAC name is (5Z)-5-[(2-ethoxy-3,5-diiodophenyl)methylidene]-3-(4-nitrophenyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(2-ethoxy-3,5-diiodophenyl)methylidene]-3-(4-nitrophenyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126345530 |
| Molecular Formula | C18H12I2N2O4S2 |
| Molecular Weight | 638.25 g/mol |
| Exact Mass | 637.83 |
| IUPAC Name | (5Z)-5-[(2-ethoxy-3,5-diiodophenyl)methylidene]-3-(4-nitrophenyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCOc1c(I)cc(I)cc1/C=C1\SC(=S)N(c2ccc([N+](=O)[O-])cc2)C1=O |
| InChI | InChI=1S/C18H12I2N2O4S2/c1-2-26-16-10(7-11(19)9-14(16)20)8-15-17(23)21(18(27)28-15)12-3-5-13(6-4-12)22(24)25/h3-9H,2H2,1H3/b15-8- |
| InChIKey | UYSUAIBAWFSWHV-NVNXTCNLSA-N |
| XLogP | 5.61 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.25 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|