C24H14Br2ClFN2O3S2 — CID 126340353
4-chloro-N-[(5E)-5-[[3,5-dibromo-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide (PubChem CID 126340353) has the molecular formula C24H14Br2ClFN2O3S2 and a molecular weight of 656.78 g/mol. Its IUPAC name is 4-chloro-N-[(5E)-5-[[3,5-dibromo-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide.
| Compound Name | 4-chloro-N-[(5E)-5-[[3,5-dibromo-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 126340353 |
| Molecular Formula | C24H14Br2ClFN2O3S2 |
| Molecular Weight | 656.78 g/mol |
| Exact Mass | 653.85 |
| IUPAC Name | 4-chloro-N-[(5E)-5-[[3,5-dibromo-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
| SMILES | O=C(NN1C(=O)/C(=C\c2cc(Br)c(OCc3ccc(F)cc3)c(Br)c2)SC1=S)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H14Br2ClFN2O3S2/c25-18-9-14(10-19(26)21(18)33-12-13-1-7-17(28)8-2-13)11-20-23(32)30(24(34)35-20)29-22(31)15-3-5-16(27)6-4-15/h1-11H,12H2,(H,29,31)/b20-11+ |
| InChIKey | WBRWCBJHMVRXDE-RGVLZGJSSA-N |
| XLogP | 7.13 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.78 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|