C28H24BrClN2O4S2 — CID 19200572
N-[(5E)-5-[[3-bromo-5-methoxy-4-[(2,4,5-trimethylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-chlorobenzamide (PubChem CID 19200572) has the molecular formula C28H24BrClN2O4S2 and a molecular weight of 632.00 g/mol. Its IUPAC name is N-[(5E)-5-[[3-bromo-5-methoxy-4-[(2,4,5-trimethylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-chlorobenzamide.
| Compound Name | N-[(5E)-5-[[3-bromo-5-methoxy-4-[(2,4,5-trimethylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 19200572 |
| Molecular Formula | C28H24BrClN2O4S2 |
| Molecular Weight | 632.00 g/mol |
| Exact Mass | 630.00 |
| IUPAC Name | N-[(5E)-5-[[3-bromo-5-methoxy-4-[(2,4,5-trimethylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-chlorobenzamide |
| SMILES | COc1cc(/C=C2/SC(=S)N(NC(=O)c3ccc(Cl)cc3)C2=O)cc(Br)c1OCc1cc(C)c(C)cc1C |
| InChI | InChI=1S/C28H24BrClN2O4S2/c1-15-9-17(3)20(10-16(15)2)14-36-25-22(29)11-18(12-23(25)35-4)13-24-27(34)32(28(37)38-24)31-26(33)19-5-7-21(30)8-6-19/h5-13H,14H2,1-4H3,(H,31,33)/b24-13+ |
| InChIKey | QLAUSSNXWUVQME-ZMOGYAJESA-N |
| XLogP | 7.16 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.00 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|