C25H19N3O2S3 — CID 126345092
N-[(5Z)-5-[[1-[(4-methylphenyl)methyl]indol-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]thiophene-2-carboxamide (PubChem CID 126345092) has the molecular formula C25H19N3O2S3 and a molecular weight of 489.65 g/mol. Its IUPAC name is N-[(5Z)-5-[[1-[(4-methylphenyl)methyl]indol-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]thiophene-2-carboxamide.
| Compound Name | N-[(5Z)-5-[[1-[(4-methylphenyl)methyl]indol-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 126345092 |
| Molecular Formula | C25H19N3O2S3 |
| Molecular Weight | 489.65 g/mol |
| Exact Mass | 489.06 |
| IUPAC Name | N-[(5Z)-5-[[1-[(4-methylphenyl)methyl]indol-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]thiophene-2-carboxamide |
| SMILES | Cc1ccc(Cn2cc(/C=C3\SC(=S)N(NC(=O)c4cccs4)C3=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C25H19N3O2S3/c1-16-8-10-17(11-9-16)14-27-15-18(19-5-2-3-6-20(19)27)13-22-24(30)28(25(31)33-22)26-23(29)21-7-4-12-32-21/h2-13,15H,14H2,1H3,(H,26,29)/b22-13- |
| InChIKey | RBOUIYUPIKGTAW-XKZIYDEJSA-N |
| XLogP | 5.61 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.65 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|