C21H18N2OS — CID 118463358
N-[1-[(4-methylphenyl)methyl]indol-3-yl]thiophene-2-carboxamide (PubChem CID 118463358) has the molecular formula C21H18N2OS and a molecular weight of 346.46 g/mol. Its IUPAC name is N-[1-[(4-methylphenyl)methyl]indol-3-yl]thiophene-2-carboxamide.
| Compound Name | N-[1-[(4-methylphenyl)methyl]indol-3-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 118463358 |
| Molecular Formula | C21H18N2OS |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | N-[1-[(4-methylphenyl)methyl]indol-3-yl]thiophene-2-carboxamide |
| SMILES | Cc1ccc(Cn2cc(NC(=O)c3cccs3)c3ccccc32)cc1 |
| InChI | InChI=1S/C21H18N2OS/c1-15-8-10-16(11-9-15)13-23-14-18(17-5-2-3-6-19(17)23)22-21(24)20-7-4-12-25-20/h2-12,14H,13H2,1H3,(H,22,24) |
| InChIKey | BKSRTXNZCLSGRX-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |