C27H28N4O3S — CID 126345598
N-[(1-benzylpiperidin-4-ylidene)amino]-4-[(2R)-3-(furan-2-ylmethyl)-4-oxo-1,3-thiazolidin-2-yl]benzamide (PubChem CID 126345598) has the molecular formula C27H28N4O3S and a molecular weight of 488.61 g/mol. Its IUPAC name is N-[(1-benzylpiperidin-4-ylidene)amino]-4-[(2R)-3-(furan-2-ylmethyl)-4-oxo-1,3-thiazolidin-2-yl]benzamide.
| Compound Name | N-[(1-benzylpiperidin-4-ylidene)amino]-4-[(2R)-3-(furan-2-ylmethyl)-4-oxo-1,3-thiazolidin-2-yl]benzamide |
|---|---|
| PubChem CID | 126345598 |
| Molecular Formula | C27H28N4O3S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | N-[(1-benzylpiperidin-4-ylidene)amino]-4-[(2R)-3-(furan-2-ylmethyl)-4-oxo-1,3-thiazolidin-2-yl]benzamide |
| SMILES | O=C(NN=C1CCN(Cc2ccccc2)CC1)c1ccc([C@H]2SCC(=O)N2Cc2ccco2)cc1 |
| InChI | InChI=1S/C27H28N4O3S/c32-25-19-35-27(31(25)18-24-7-4-16-34-24)22-10-8-21(9-11-22)26(33)29-28-23-12-14-30(15-13-23)17-20-5-2-1-3-6-20/h1-11,16,27H,12-15,17-19H2,(H,29,33)/t27-/m1/s1 |
| InChIKey | ILKRMTFOCSEUCK-HHHXNRCGSA-N |
| XLogP | 4.44 |
| TPSA | 78.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|