C30H32N4O2S — CID 126347887
N-[(1-benzylpiperidin-4-ylidene)amino]-4-[(2S)-4-oxo-3-(2-phenylethyl)-1,3-thiazolidin-2-yl]benzamide (PubChem CID 126347887) has the molecular formula C30H32N4O2S and a molecular weight of 512.68 g/mol. Its IUPAC name is N-[(1-benzylpiperidin-4-ylidene)amino]-4-[(2S)-4-oxo-3-(2-phenylethyl)-1,3-thiazolidin-2-yl]benzamide.
| Compound Name | N-[(1-benzylpiperidin-4-ylidene)amino]-4-[(2S)-4-oxo-3-(2-phenylethyl)-1,3-thiazolidin-2-yl]benzamide |
|---|---|
| PubChem CID | 126347887 |
| Molecular Formula | C30H32N4O2S |
| Molecular Weight | 512.68 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | N-[(1-benzylpiperidin-4-ylidene)amino]-4-[(2S)-4-oxo-3-(2-phenylethyl)-1,3-thiazolidin-2-yl]benzamide |
| SMILES | O=C(NN=C1CCN(Cc2ccccc2)CC1)c1ccc([C@@H]2SCC(=O)N2CCc2ccccc2)cc1 |
| InChI | InChI=1S/C30H32N4O2S/c35-28-22-37-30(34(28)20-15-23-7-3-1-4-8-23)26-13-11-25(12-14-26)29(36)32-31-27-16-18-33(19-17-27)21-24-9-5-2-6-10-24/h1-14,30H,15-22H2,(H,32,36)/t30-/m0/s1 |
| InChIKey | CAVQZGNBWDCTKS-PMERELPUSA-N |
| XLogP | 4.89 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.68 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|