C26H27BrN2O3S2 — CID 126347526
N-(2-bromo-4,5-dimethylphenyl)-2-[4-[(Z)-(3-cyclohexyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetamide (PubChem CID 126347526) has the molecular formula C26H27BrN2O3S2 and a molecular weight of 559.55 g/mol. Its IUPAC name is N-(2-bromo-4,5-dimethylphenyl)-2-[4-[(Z)-(3-cyclohexyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetamide.
| Compound Name | N-(2-bromo-4,5-dimethylphenyl)-2-[4-[(Z)-(3-cyclohexyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126347526 |
| Molecular Formula | C26H27BrN2O3S2 |
| Molecular Weight | 559.55 g/mol |
| Exact Mass | 558.06 |
| IUPAC Name | N-(2-bromo-4,5-dimethylphenyl)-2-[4-[(Z)-(3-cyclohexyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetamide |
| SMILES | Cc1cc(Br)c(NC(=O)COc2ccc(/C=C3\SC(=S)N(C4CCCCC4)C3=O)cc2)cc1C |
| InChI | InChI=1S/C26H27BrN2O3S2/c1-16-12-21(27)22(13-17(16)2)28-24(30)15-32-20-10-8-18(9-11-20)14-23-25(31)29(26(33)34-23)19-6-4-3-5-7-19/h8-14,19H,3-7,15H2,1-2H3,(H,28,30)/b23-14- |
| InChIKey | AXBMUUNNOLHDSC-UCQKPKSFSA-N |
| XLogP | 6.62 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.55 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|