C31H25BrN2O4S — CID 3440271
N-(2-bromo-4,5-dimethylphenyl)-2-[4-[[3-(naphthalen-2-ylmethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide (PubChem CID 3440271) has the molecular formula C31H25BrN2O4S and a molecular weight of 601.52 g/mol. Its IUPAC name is N-(2-bromo-4,5-dimethylphenyl)-2-[4-[[3-(naphthalen-2-ylmethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide.
| Compound Name | N-(2-bromo-4,5-dimethylphenyl)-2-[4-[[3-(naphthalen-2-ylmethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 3440271 |
| Molecular Formula | C31H25BrN2O4S |
| Molecular Weight | 601.52 g/mol |
| Exact Mass | 600.07 |
| IUPAC Name | N-(2-bromo-4,5-dimethylphenyl)-2-[4-[[3-(naphthalen-2-ylmethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide |
| SMILES | Cc1cc(Br)c(NC(=O)COc2ccc(C=C3SC(=O)N(Cc4ccc5ccccc5c4)C3=O)cc2)cc1C |
| InChI | InChI=1S/C31H25BrN2O4S/c1-19-13-26(32)27(14-20(19)2)33-29(35)18-38-25-11-8-21(9-12-25)16-28-30(36)34(31(37)39-28)17-22-7-10-23-5-3-4-6-24(23)15-22/h3-16H,17-18H2,1-2H3,(H,33,35) |
| InChIKey | CYJSXCLQMRKOFL-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.52 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|