C27H22BrFN2O4S — CID 124664279
N-(2-bromo-4,5-dimethylphenyl)-2-[4-[(E)-[3-[(2-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide (PubChem CID 124664279) has the molecular formula C27H22BrFN2O4S and a molecular weight of 569.45 g/mol. Its IUPAC name is N-(2-bromo-4,5-dimethylphenyl)-2-[4-[(E)-[3-[(2-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide.
| Compound Name | N-(2-bromo-4,5-dimethylphenyl)-2-[4-[(E)-[3-[(2-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 124664279 |
| Molecular Formula | C27H22BrFN2O4S |
| Molecular Weight | 569.45 g/mol |
| Exact Mass | 568.05 |
| IUPAC Name | N-(2-bromo-4,5-dimethylphenyl)-2-[4-[(E)-[3-[(2-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide |
| SMILES | Cc1cc(Br)c(NC(=O)COc2ccc(/C=C3/SC(=O)N(Cc4ccccc4F)C3=O)cc2)cc1C |
| InChI | InChI=1S/C27H22BrFN2O4S/c1-16-11-21(28)23(12-17(16)2)30-25(32)15-35-20-9-7-18(8-10-20)13-24-26(33)31(27(34)36-24)14-19-5-3-4-6-22(19)29/h3-13H,14-15H2,1-2H3,(H,30,32)/b24-13+ |
| InChIKey | BDDDIGBTBWINBX-ZMOGYAJESA-N |
| XLogP | 6.46 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.45 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|