C20H18FNO3S — CID 17272541
(5E)-3-[(2-fluorophenyl)methyl]-5-[(4-propoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 17272541) has the molecular formula C20H18FNO3S and a molecular weight of 371.43 g/mol. Its IUPAC name is (5E)-3-[(2-fluorophenyl)methyl]-5-[(4-propoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-[(2-fluorophenyl)methyl]-5-[(4-propoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 17272541 |
| Molecular Formula | C20H18FNO3S |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | (5E)-3-[(2-fluorophenyl)methyl]-5-[(4-propoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CCCOc1ccc(/C=C2/SC(=O)N(Cc3ccccc3F)C2=O)cc1 |
| InChI | InChI=1S/C20H18FNO3S/c1-2-11-25-16-9-7-14(8-10-16)12-18-19(23)22(20(24)26-18)13-15-5-3-4-6-17(15)21/h3-10,12H,2,11,13H2,1H3/b18-12+ |
| InChIKey | YDZNIVPYEJHBMQ-LDADJPATSA-N |
| XLogP | 4.85 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|