C10H12O — CID 12634769
3-cyclohexa-1,4-dien-1-yl-2,3-dihydrofuran (PubChem CID 12634769) has the molecular formula C10H12O and a molecular weight of 148.20 g/mol. Its IUPAC name is 3-cyclohexa-1,4-dien-1-yl-2,3-dihydrofuran.
| Compound Name | 3-cyclohexa-1,4-dien-1-yl-2,3-dihydrofuran |
|---|---|
| PubChem CID | 12634769 |
| Molecular Formula | C10H12O |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | 3-cyclohexa-1,4-dien-1-yl-2,3-dihydrofuran |
| SMILES | C1=CCC(C2C=COC2)=CC1 |
| InChI | InChI=1S/C10H12O/c1-2-4-9(5-3-1)10-6-7-11-8-10/h1-2,5-7,10H,3-4,8H2 |
| InChIKey | YGEDUQGQJYQDEI-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|