C18H18BrNO5S2 — CID 126351395
ethyl 2-[2-bromo-6-methoxy-4-[(E)-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetate (PubChem CID 126351395) has the molecular formula C18H18BrNO5S2 and a molecular weight of 472.38 g/mol. Its IUPAC name is ethyl 2-[2-bromo-6-methoxy-4-[(E)-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-bromo-6-methoxy-4-[(E)-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126351395 |
| Molecular Formula | C18H18BrNO5S2 |
| Molecular Weight | 472.38 g/mol |
| Exact Mass | 470.98 |
| IUPAC Name | ethyl 2-[2-bromo-6-methoxy-4-[(E)-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetate |
| SMILES | C=CCN1C(=O)/C(=C\c2cc(Br)c(OCC(=O)OCC)c(OC)c2)SC1=S |
| InChI | InChI=1S/C18H18BrNO5S2/c1-4-6-20-17(22)14(27-18(20)26)9-11-7-12(19)16(13(8-11)23-3)25-10-15(21)24-5-2/h4,7-9H,1,5-6,10H2,2-3H3/b14-9+ |
| InChIKey | IMBKSLIWHQGZRN-NTEUORMPSA-N |
| XLogP | 3.79 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.38 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|