C23H12Br2Cl3NO2S2 — CID 126351755
(5Z)-5-[[3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-3-(2,4-dichlorophenyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126351755) has the molecular formula C23H12Br2Cl3NO2S2 and a molecular weight of 664.66 g/mol. Its IUPAC name is (5Z)-5-[[3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-3-(2,4-dichlorophenyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-3-(2,4-dichlorophenyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126351755 |
| Molecular Formula | C23H12Br2Cl3NO2S2 |
| Molecular Weight | 664.66 g/mol |
| Exact Mass | 660.77 |
| IUPAC Name | (5Z)-5-[[3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-3-(2,4-dichlorophenyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2cc(Br)c(OCc3ccccc3Cl)c(Br)c2)SC(=S)N1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H12Br2Cl3NO2S2/c24-15-7-12(8-16(25)21(15)31-11-13-3-1-2-4-17(13)27)9-20-22(30)29(23(32)33-20)19-6-5-14(26)10-18(19)28/h1-10H,11H2/b20-9- |
| InChIKey | MHQXUOOJDPVSTA-UKWGHVSLSA-N |
| XLogP | 9.16 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.66 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|