C23H21IN4O3S — CID 126352064
N-(4-iodo-2-methylphenyl)-2-[[5-(7-methoxy-1-benzofuran-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 126352064) has the molecular formula C23H21IN4O3S and a molecular weight of 560.42 g/mol. Its IUPAC name is N-(4-iodo-2-methylphenyl)-2-[[5-(7-methoxy-1-benzofuran-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(4-iodo-2-methylphenyl)-2-[[5-(7-methoxy-1-benzofuran-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 126352064 |
| Molecular Formula | C23H21IN4O3S |
| Molecular Weight | 560.42 g/mol |
| Exact Mass | 560.04 |
| IUPAC Name | N-(4-iodo-2-methylphenyl)-2-[[5-(7-methoxy-1-benzofuran-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccc(I)cc2C)nnc1-c1cc2cccc(OC)c2o1 |
| InChI | InChI=1S/C23H21IN4O3S/c1-4-10-28-22(19-12-15-6-5-7-18(30-3)21(15)31-19)26-27-23(28)32-13-20(29)25-17-9-8-16(24)11-14(17)2/h4-9,11-12H,1,10,13H2,2-3H3,(H,25,29) |
| InChIKey | LDRZKHKILVTJBR-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.42 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|