C24H22N4O5S — CID 126352943
methyl 2-[[2-[[5-(7-methoxy-1-benzofuran-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate (PubChem CID 126352943) has the molecular formula C24H22N4O5S and a molecular weight of 478.53 g/mol. Its IUPAC name is methyl 2-[[2-[[5-(7-methoxy-1-benzofuran-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-[[5-(7-methoxy-1-benzofuran-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126352943 |
| Molecular Formula | C24H22N4O5S |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | methyl 2-[[2-[[5-(7-methoxy-1-benzofuran-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate |
| SMILES | C=CCn1c(SCC(=O)Nc2ccccc2C(=O)OC)nnc1-c1cc2cccc(OC)c2o1 |
| InChI | InChI=1S/C24H22N4O5S/c1-4-12-28-22(19-13-15-8-7-11-18(31-2)21(15)33-19)26-27-24(28)34-14-20(29)25-17-10-6-5-9-16(17)23(30)32-3/h4-11,13H,1,12,14H2,2-3H3,(H,25,29) |
| InChIKey | NOQJRQWVRPUJPK-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|