C23H23Cl2N5O3S — CID 126352594
2,4-dichloro-N-[(1R)-2-methyl-1-[5-[(4-nitrophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]propyl]benzamide (PubChem CID 126352594) has the molecular formula C23H23Cl2N5O3S and a molecular weight of 520.44 g/mol. Its IUPAC name is 2,4-dichloro-N-[(1R)-2-methyl-1-[5-[(4-nitrophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]propyl]benzamide.
| Compound Name | 2,4-dichloro-N-[(1R)-2-methyl-1-[5-[(4-nitrophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]propyl]benzamide |
|---|---|
| PubChem CID | 126352594 |
| Molecular Formula | C23H23Cl2N5O3S |
| Molecular Weight | 520.44 g/mol |
| Exact Mass | 519.09 |
| IUPAC Name | 2,4-dichloro-N-[(1R)-2-methyl-1-[5-[(4-nitrophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]propyl]benzamide |
| SMILES | C=CCn1c(SCc2ccc([N+](=O)[O-])cc2)nnc1[C@H](NC(=O)c1ccc(Cl)cc1Cl)C(C)C |
| InChI | InChI=1S/C23H23Cl2N5O3S/c1-4-11-29-21(20(14(2)3)26-22(31)18-10-7-16(24)12-19(18)25)27-28-23(29)34-13-15-5-8-17(9-6-15)30(32)33/h4-10,12,14,20H,1,11,13H2,2-3H3,(H,26,31)/t20-/m1/s1 |
| InChIKey | PIFWATRYYLSAQY-HXUWFJFHSA-N |
| XLogP | 6.10 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.44 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|