C20H15BrN2O6S2 — CID 126355530
ethyl 2-[4-bromo-2-[(Z)-[3-(3-nitrophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate (PubChem CID 126355530) has the molecular formula C20H15BrN2O6S2 and a molecular weight of 523.39 g/mol. Its IUPAC name is ethyl 2-[4-bromo-2-[(Z)-[3-(3-nitrophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[4-bromo-2-[(Z)-[3-(3-nitrophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126355530 |
| Molecular Formula | C20H15BrN2O6S2 |
| Molecular Weight | 523.39 g/mol |
| Exact Mass | 521.96 |
| IUPAC Name | ethyl 2-[4-bromo-2-[(Z)-[3-(3-nitrophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(Br)cc1/C=C1\SC(=S)N(c2cccc([N+](=O)[O-])c2)C1=O |
| InChI | InChI=1S/C20H15BrN2O6S2/c1-2-28-18(24)11-29-16-7-6-13(21)8-12(16)9-17-19(25)22(20(30)31-17)14-4-3-5-15(10-14)23(26)27/h3-10H,2,11H2,1H3/b17-9- |
| InChIKey | WATLDSRVWYROGD-MFOYZWKCSA-N |
| XLogP | 4.70 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.39 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|