C22H15NO3S2 — CID 126356123
[4-[(Z)-(3-naphthalen-1-yl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] acetate (PubChem CID 126356123) has the molecular formula C22H15NO3S2 and a molecular weight of 405.50 g/mol. Its IUPAC name is [4-[(Z)-(3-naphthalen-1-yl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] acetate.
| Compound Name | [4-[(Z)-(3-naphthalen-1-yl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] acetate |
|---|---|
| PubChem CID | 126356123 |
| Molecular Formula | C22H15NO3S2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | [4-[(Z)-(3-naphthalen-1-yl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(/C=C2\SC(=S)N(c3cccc4ccccc34)C2=O)cc1 |
| InChI | InChI=1S/C22H15NO3S2/c1-14(24)26-17-11-9-15(10-12-17)13-20-21(25)23(22(27)28-20)19-8-4-6-16-5-2-3-7-18(16)19/h2-13H,1H3/b20-13- |
| InChIKey | YCIQQHLEUFQWIC-MOSHPQCFSA-N |
| XLogP | 5.17 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|