C21H18BrIN2O4S — CID 126358513
2-[(5Z)-5-[(3-bromo-4-propoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-iodophenyl)acetamide (PubChem CID 126358513) has the molecular formula C21H18BrIN2O4S and a molecular weight of 601.26 g/mol. Its IUPAC name is 2-[(5Z)-5-[(3-bromo-4-propoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-iodophenyl)acetamide.
| Compound Name | 2-[(5Z)-5-[(3-bromo-4-propoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-iodophenyl)acetamide |
|---|---|
| PubChem CID | 126358513 |
| Molecular Formula | C21H18BrIN2O4S |
| Molecular Weight | 601.26 g/mol |
| Exact Mass | 599.92 |
| IUPAC Name | 2-[(5Z)-5-[(3-bromo-4-propoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-iodophenyl)acetamide |
| SMILES | CCCOc1ccc(/C=C2\SC(=O)N(CC(=O)Nc3ccc(I)cc3)C2=O)cc1Br |
| InChI | InChI=1S/C21H18BrIN2O4S/c1-2-9-29-17-8-3-13(10-16(17)22)11-18-20(27)25(21(28)30-18)12-19(26)24-15-6-4-14(23)5-7-15/h3-8,10-11H,2,9,12H2,1H3,(H,24,26)/b18-11- |
| InChIKey | ZENSYNLHYSLRDY-WQRHYEAKSA-N |
| XLogP | 5.52 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.26 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|