C30H29N3O5S — CID 126358681
2-[(5Z)-5-[[4-[2-(3,4-dimethylanilino)-2-oxoethoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,3-dimethylphenyl)acetamide (PubChem CID 126358681) has the molecular formula C30H29N3O5S and a molecular weight of 543.65 g/mol. Its IUPAC name is 2-[(5Z)-5-[[4-[2-(3,4-dimethylanilino)-2-oxoethoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,3-dimethylphenyl)acetamide.
| Compound Name | 2-[(5Z)-5-[[4-[2-(3,4-dimethylanilino)-2-oxoethoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,3-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 126358681 |
| Molecular Formula | C30H29N3O5S |
| Molecular Weight | 543.65 g/mol |
| Exact Mass | 543.18 |
| IUPAC Name | 2-[(5Z)-5-[[4-[2-(3,4-dimethylanilino)-2-oxoethoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,3-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)COc2ccc(/C=C3\SC(=O)N(CC(=O)Nc4cccc(C)c4C)C3=O)cc2)cc1C |
| InChI | InChI=1S/C30H29N3O5S/c1-18-8-11-23(14-20(18)3)31-28(35)17-38-24-12-9-22(10-13-24)15-26-29(36)33(30(37)39-26)16-27(34)32-25-7-5-6-19(2)21(25)4/h5-15H,16-17H2,1-4H3,(H,31,35)(H,32,34)/b26-15- |
| InChIKey | GDADJTLDLWYEKO-YSMPRRRNSA-N |
| XLogP | 5.61 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.65 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|