C22H20FN5O4S — CID 126359645
4-[[2-[[5-[[(2-fluorobenzoyl)amino]methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoic acid (PubChem CID 126359645) has the molecular formula C22H20FN5O4S and a molecular weight of 469.50 g/mol. Its IUPAC name is 4-[[2-[[5-[[(2-fluorobenzoyl)amino]methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoic acid.
| Compound Name | 4-[[2-[[5-[[(2-fluorobenzoyl)amino]methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 126359645 |
| Molecular Formula | C22H20FN5O4S |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | 4-[[2-[[5-[[(2-fluorobenzoyl)amino]methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoic acid |
| SMILES | C=CCn1c(CNC(=O)c2ccccc2F)nnc1SCC(=O)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C22H20FN5O4S/c1-2-11-28-18(12-24-20(30)16-5-3-4-6-17(16)23)26-27-22(28)33-13-19(29)25-15-9-7-14(8-10-15)21(31)32/h2-10H,1,11-13H2,(H,24,30)(H,25,29)(H,31,32) |
| InChIKey | YWKNEAUZDOWOGL-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 126.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|