C22H21BrFN5O2S — CID 5015830
N-[2-[5-[2-(4-bromoanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]-2-fluorobenzamide (PubChem CID 5015830) has the molecular formula C22H21BrFN5O2S and a molecular weight of 518.41 g/mol. Its IUPAC name is N-[2-[5-[2-(4-bromoanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]-2-fluorobenzamide.
| Compound Name | N-[2-[5-[2-(4-bromoanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 5015830 |
| Molecular Formula | C22H21BrFN5O2S |
| Molecular Weight | 518.41 g/mol |
| Exact Mass | 517.06 |
| IUPAC Name | N-[2-[5-[2-(4-bromoanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]-2-fluorobenzamide |
| SMILES | C=CCn1c(CCNC(=O)c2ccccc2F)nnc1SCC(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C22H21BrFN5O2S/c1-2-13-29-19(11-12-25-21(31)17-5-3-4-6-18(17)24)27-28-22(29)32-14-20(30)26-16-9-7-15(23)8-10-16/h2-10H,1,11-14H2,(H,25,31)(H,26,30) |
| InChIKey | LEISMEWMIPCIET-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.41 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|