C23H24FN5O2S — CID 3291378
2-fluoro-N-[2-[5-[2-(3-methylanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide (PubChem CID 3291378) has the molecular formula C23H24FN5O2S and a molecular weight of 453.54 g/mol. Its IUPAC name is 2-fluoro-N-[2-[5-[2-(3-methylanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide.
| Compound Name | 2-fluoro-N-[2-[5-[2-(3-methylanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 3291378 |
| Molecular Formula | C23H24FN5O2S |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | 2-fluoro-N-[2-[5-[2-(3-methylanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide |
| SMILES | C=CCn1c(CCNC(=O)c2ccccc2F)nnc1SCC(=O)Nc1cccc(C)c1 |
| InChI | InChI=1S/C23H24FN5O2S/c1-3-13-29-20(11-12-25-22(31)18-9-4-5-10-19(18)24)27-28-23(29)32-15-21(30)26-17-8-6-7-16(2)14-17/h3-10,14H,1,11-13,15H2,2H3,(H,25,31)(H,26,30) |
| InChIKey | FARPVPBRNXYJLZ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|