C25H28N4O3S2 — CID 126361407
N-[(6S)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-[[5-[(4-methoxyphenyl)methyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide (PubChem CID 126361407) has the molecular formula C25H28N4O3S2 and a molecular weight of 496.66 g/mol. Its IUPAC name is N-[(6S)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-[[5-[(4-methoxyphenyl)methyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-[(6S)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-[[5-[(4-methoxyphenyl)methyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 126361407 |
| Molecular Formula | C25H28N4O3S2 |
| Molecular Weight | 496.66 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | N-[(6S)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-[[5-[(4-methoxyphenyl)methyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide |
| SMILES | COc1ccc(Cc2nnc(SCC(=O)Nc3sc4c(c3C#N)CC[C@H](C(C)(C)C)C4)o2)cc1 |
| InChI | InChI=1S/C25H28N4O3S2/c1-25(2,3)16-7-10-18-19(13-26)23(34-20(18)12-16)27-21(30)14-33-24-29-28-22(32-24)11-15-5-8-17(31-4)9-6-15/h5-6,8-9,16H,7,10-12,14H2,1-4H3,(H,27,30)/t16-/m0/s1 |
| InChIKey | DTHICYNINCIIKZ-INIZCTEOSA-N |
| XLogP | 5.48 |
| TPSA | 101.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.66 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |