C25H24Cl5N5O2S — CID 126362724
2,4-dichloro-N-[(1S)-3-methyl-1-[5-[2-oxo-2-(2,4,5-trichloroanilino)ethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]butyl]benzamide (PubChem CID 126362724) has the molecular formula C25H24Cl5N5O2S and a molecular weight of 635.83 g/mol. Its IUPAC name is 2,4-dichloro-N-[(1S)-3-methyl-1-[5-[2-oxo-2-(2,4,5-trichloroanilino)ethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]butyl]benzamide.
| Compound Name | 2,4-dichloro-N-[(1S)-3-methyl-1-[5-[2-oxo-2-(2,4,5-trichloroanilino)ethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]butyl]benzamide |
|---|---|
| PubChem CID | 126362724 |
| Molecular Formula | C25H24Cl5N5O2S |
| Molecular Weight | 635.83 g/mol |
| Exact Mass | 633.01 |
| IUPAC Name | 2,4-dichloro-N-[(1S)-3-methyl-1-[5-[2-oxo-2-(2,4,5-trichloroanilino)ethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]butyl]benzamide |
| SMILES | C=CCn1c(SCC(=O)Nc2cc(Cl)c(Cl)cc2Cl)nnc1[C@H](CC(C)C)NC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C25H24Cl5N5O2S/c1-4-7-35-23(21(8-13(2)3)32-24(37)15-6-5-14(26)9-16(15)27)33-34-25(35)38-12-22(36)31-20-11-18(29)17(28)10-19(20)30/h4-6,9-11,13,21H,1,7-8,12H2,2-3H3,(H,31,36)(H,32,37)/t21-/m0/s1 |
| InChIKey | IPYUAVASFSKQKS-NRFANRHFSA-N |
| XLogP | 7.98 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.83 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|