C25H25FN2O4S — CID 126363750
(5Z)-5-[[4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-3-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 126363750) has the molecular formula C25H25FN2O4S and a molecular weight of 468.55 g/mol. Its IUPAC name is (5Z)-5-[[4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-3-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-3-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126363750 |
| Molecular Formula | C25H25FN2O4S |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | (5Z)-5-[[4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-3-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CC1CCN(C(=O)CN2C(=O)S/C(=C\c3ccc(OCc4ccc(F)cc4)cc3)C2=O)CC1 |
| InChI | InChI=1S/C25H25FN2O4S/c1-17-10-12-27(13-11-17)23(29)15-28-24(30)22(33-25(28)31)14-18-4-8-21(9-5-18)32-16-19-2-6-20(26)7-3-19/h2-9,14,17H,10-13,15-16H2,1H3/b22-14- |
| InChIKey | MUGBYKZIBVGFCY-HMAPJEAMSA-N |
| XLogP | 4.70 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|