C26H30N6O4S — CID 126364712
3-methyl-N-[(1S)-2-methyl-1-[5-[2-(2-methyl-5-nitroanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]propyl]benzamide (PubChem CID 126364712) has the molecular formula C26H30N6O4S and a molecular weight of 522.63 g/mol. Its IUPAC name is 3-methyl-N-[(1S)-2-methyl-1-[5-[2-(2-methyl-5-nitroanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]propyl]benzamide.
| Compound Name | 3-methyl-N-[(1S)-2-methyl-1-[5-[2-(2-methyl-5-nitroanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]propyl]benzamide |
|---|---|
| PubChem CID | 126364712 |
| Molecular Formula | C26H30N6O4S |
| Molecular Weight | 522.63 g/mol |
| Exact Mass | 522.20 |
| IUPAC Name | 3-methyl-N-[(1S)-2-methyl-1-[5-[2-(2-methyl-5-nitroanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]propyl]benzamide |
| SMILES | C=CCn1c(SCC(=O)Nc2cc([N+](=O)[O-])ccc2C)nnc1[C@@H](NC(=O)c1cccc(C)c1)C(C)C |
| InChI | InChI=1S/C26H30N6O4S/c1-6-12-31-24(23(16(2)3)28-25(34)19-9-7-8-17(4)13-19)29-30-26(31)37-15-22(33)27-21-14-20(32(35)36)11-10-18(21)5/h6-11,13-14,16,23H,1,12,15H2,2-5H3,(H,27,33)(H,28,34)/t23-/m0/s1 |
| InChIKey | NISAZBPZDFMDEK-QHCPKHFHSA-N |
| XLogP | 4.85 |
| TPSA | 132.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.63 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|