C31H23Cl2I2N3O6S — CID 126371378
ethyl (2E,5S)-2-[[4-[(2,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-7-methyl-5-(4-methyl-3-nitrophenyl)-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 126371378) has the molecular formula C31H23Cl2I2N3O6S and a molecular weight of 890.32 g/mol. Its IUPAC name is ethyl (2E,5S)-2-[[4-[(2,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-7-methyl-5-(4-methyl-3-nitrophenyl)-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (2E,5S)-2-[[4-[(2,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-7-methyl-5-(4-methyl-3-nitrophenyl)-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 126371378 |
| Molecular Formula | C31H23Cl2I2N3O6S |
| Molecular Weight | 890.32 g/mol |
| Exact Mass | 888.88 |
| IUPAC Name | ethyl (2E,5S)-2-[[4-[(2,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-7-methyl-5-(4-methyl-3-nitrophenyl)-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N=c2s/c(=C/c3cc(I)c(OCc4ccc(Cl)cc4Cl)c(I)c3)c(=O)n2[C@H]1c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C31H23Cl2I2N3O6S/c1-4-43-30(40)26-16(3)36-31-37(27(26)18-6-5-15(2)24(12-18)38(41)42)29(39)25(45-31)11-17-9-22(34)28(23(35)10-17)44-14-19-7-8-20(32)13-21(19)33/h5-13,27H,4,14H2,1-3H3/b25-11+/t27-/m0/s1 |
| InChIKey | VGWPUNNSPNNRNT-AWQNYARGSA-N |
| XLogP | 7.11 |
| TPSA | 113.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 890.32 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|