C24H19I2N3O6S — CID 126150071
ethyl (2E,5R)-2-[(4-hydroxy-3,5-diiodophenyl)methylidene]-7-methyl-5-(4-methyl-3-nitrophenyl)-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 126150071) has the molecular formula C24H19I2N3O6S and a molecular weight of 731.31 g/mol. Its IUPAC name is ethyl (2E,5R)-2-[(4-hydroxy-3,5-diiodophenyl)methylidene]-7-methyl-5-(4-methyl-3-nitrophenyl)-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (2E,5R)-2-[(4-hydroxy-3,5-diiodophenyl)methylidene]-7-methyl-5-(4-methyl-3-nitrophenyl)-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 126150071 |
| Molecular Formula | C24H19I2N3O6S |
| Molecular Weight | 731.31 g/mol |
| Exact Mass | 730.91 |
| IUPAC Name | ethyl (2E,5R)-2-[(4-hydroxy-3,5-diiodophenyl)methylidene]-7-methyl-5-(4-methyl-3-nitrophenyl)-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N=c2s/c(=C/c3cc(I)c(O)c(I)c3)c(=O)n2[C@@H]1c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H19I2N3O6S/c1-4-35-23(32)19-12(3)27-24-28(20(19)14-6-5-11(2)17(10-14)29(33)34)22(31)18(36-24)9-13-7-15(25)21(30)16(26)8-13/h5-10,20,30H,4H2,1-3H3/b18-9+/t20-/m1/s1 |
| InChIKey | HVSHAQHOCWAWGS-KHVWPYCOSA-N |
| XLogP | 3.93 |
| TPSA | 124.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.31 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|