C24H21N3O7S — CID 126188584
ethyl (2E,5R)-2-[(2,4-dihydroxyphenyl)methylidene]-7-methyl-5-(4-methyl-3-nitrophenyl)-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 126188584) has the molecular formula C24H21N3O7S and a molecular weight of 495.51 g/mol. Its IUPAC name is ethyl (2E,5R)-2-[(2,4-dihydroxyphenyl)methylidene]-7-methyl-5-(4-methyl-3-nitrophenyl)-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (2E,5R)-2-[(2,4-dihydroxyphenyl)methylidene]-7-methyl-5-(4-methyl-3-nitrophenyl)-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 126188584 |
| Molecular Formula | C24H21N3O7S |
| Molecular Weight | 495.51 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | ethyl (2E,5R)-2-[(2,4-dihydroxyphenyl)methylidene]-7-methyl-5-(4-methyl-3-nitrophenyl)-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N=c2s/c(=C/c3ccc(O)cc3O)c(=O)n2[C@@H]1c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H21N3O7S/c1-4-34-23(31)20-13(3)25-24-26(21(20)15-6-5-12(2)17(9-15)27(32)33)22(30)19(35-24)10-14-7-8-16(28)11-18(14)29/h5-11,21,28-29H,4H2,1-3H3/b19-10+/t21-/m1/s1 |
| InChIKey | JVCHYVCBUMNTEX-IDQDRXHYSA-N |
| XLogP | 2.43 |
| TPSA | 144.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.51 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|