C26H22N4O5S — CID 126364724
ethyl (2E,5S)-2-(1H-indol-3-ylmethylidene)-7-methyl-5-(4-methyl-3-nitrophenyl)-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 126364724) has the molecular formula C26H22N4O5S and a molecular weight of 502.55 g/mol. Its IUPAC name is ethyl (2E,5S)-2-(1H-indol-3-ylmethylidene)-7-methyl-5-(4-methyl-3-nitrophenyl)-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (2E,5S)-2-(1H-indol-3-ylmethylidene)-7-methyl-5-(4-methyl-3-nitrophenyl)-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 126364724 |
| Molecular Formula | C26H22N4O5S |
| Molecular Weight | 502.55 g/mol |
| Exact Mass | 502.13 |
| IUPAC Name | ethyl (2E,5S)-2-(1H-indol-3-ylmethylidene)-7-methyl-5-(4-methyl-3-nitrophenyl)-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N=c2s/c(=C/c3c[nH]c4ccccc34)c(=O)n2[C@H]1c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H22N4O5S/c1-4-35-25(32)22-15(3)28-26-29(23(22)16-10-9-14(2)20(11-16)30(33)34)24(31)21(36-26)12-17-13-27-19-8-6-5-7-18(17)19/h5-13,23,27H,4H2,1-3H3/b21-12+/t23-/m0/s1 |
| InChIKey | NKBFYJVHRLJTMI-NWKGEQBZSA-N |
| XLogP | 3.50 |
| TPSA | 119.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.55 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|