C29H24N4O5S — CID 126349820
ethyl (2E,5R)-7-methyl-5-(4-methyl-3-nitrophenyl)-3-oxo-2-[(1-prop-2-ynylindol-3-yl)methylidene]-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 126349820) has the molecular formula C29H24N4O5S and a molecular weight of 540.60 g/mol. Its IUPAC name is ethyl (2E,5R)-7-methyl-5-(4-methyl-3-nitrophenyl)-3-oxo-2-[(1-prop-2-ynylindol-3-yl)methylidene]-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (2E,5R)-7-methyl-5-(4-methyl-3-nitrophenyl)-3-oxo-2-[(1-prop-2-ynylindol-3-yl)methylidene]-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 126349820 |
| Molecular Formula | C29H24N4O5S |
| Molecular Weight | 540.60 g/mol |
| Exact Mass | 540.15 |
| IUPAC Name | ethyl (2E,5R)-7-methyl-5-(4-methyl-3-nitrophenyl)-3-oxo-2-[(1-prop-2-ynylindol-3-yl)methylidene]-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | C#CCn1cc(/C=c2/sc3n(c2=O)[C@H](c2ccc(C)c([N+](=O)[O-])c2)C(C(=O)OCC)=C(C)N=3)c2ccccc21 |
| InChI | InChI=1S/C29H24N4O5S/c1-5-13-31-16-20(21-9-7-8-10-22(21)31)15-24-27(34)32-26(19-12-11-17(3)23(14-19)33(36)37)25(28(35)38-6-2)18(4)30-29(32)39-24/h1,7-12,14-16,26H,6,13H2,2-4H3/b24-15+/t26-/m1/s1 |
| InChIKey | FNNGXLSUQYBGPH-KMBIYUNPSA-N |
| XLogP | 3.60 |
| TPSA | 108.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.60 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|