C31H29BrN4O5S — CID 124587452
ethyl (2E,5S)-2-[[1-(3-bromo-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-7-methyl-5-(4-methyl-3-nitrophenyl)-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 124587452) has the molecular formula C31H29BrN4O5S and a molecular weight of 649.57 g/mol. Its IUPAC name is ethyl (2E,5S)-2-[[1-(3-bromo-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-7-methyl-5-(4-methyl-3-nitrophenyl)-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (2E,5S)-2-[[1-(3-bromo-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-7-methyl-5-(4-methyl-3-nitrophenyl)-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 124587452 |
| Molecular Formula | C31H29BrN4O5S |
| Molecular Weight | 649.57 g/mol |
| Exact Mass | 648.10 |
| IUPAC Name | ethyl (2E,5S)-2-[[1-(3-bromo-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-7-methyl-5-(4-methyl-3-nitrophenyl)-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N=c2s/c(=C/c3cc(C)n(-c4ccc(C)c(Br)c4)c3C)c(=O)n2[C@H]1c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C31H29BrN4O5S/c1-7-41-30(38)27-19(5)33-31-35(28(27)21-10-8-17(3)25(13-21)36(39)40)29(37)26(42-31)14-22-12-18(4)34(20(22)6)23-11-9-16(2)24(32)15-23/h8-15,28H,7H2,1-6H3/b26-14+/t28-/m0/s1 |
| InChIKey | SEZHOFSLRXVYTD-GKTKDVHMSA-N |
| XLogP | 5.49 |
| TPSA | 108.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.57 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|