C36H31N5O7S — CID 3453313
ethyl 2-[[2,5-dimethyl-1-[4-(4-nitrophenyl)phenyl]pyrrol-3-yl]methylidene]-7-methyl-5-(4-methyl-3-nitrophenyl)-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 3453313) has the molecular formula C36H31N5O7S and a molecular weight of 677.74 g/mol. Its IUPAC name is ethyl 2-[[2,5-dimethyl-1-[4-(4-nitrophenyl)phenyl]pyrrol-3-yl]methylidene]-7-methyl-5-(4-methyl-3-nitrophenyl)-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl 2-[[2,5-dimethyl-1-[4-(4-nitrophenyl)phenyl]pyrrol-3-yl]methylidene]-7-methyl-5-(4-methyl-3-nitrophenyl)-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 3453313 |
| Molecular Formula | C36H31N5O7S |
| Molecular Weight | 677.74 g/mol |
| Exact Mass | 677.19 |
| IUPAC Name | ethyl 2-[[2,5-dimethyl-1-[4-(4-nitrophenyl)phenyl]pyrrol-3-yl]methylidene]-7-methyl-5-(4-methyl-3-nitrophenyl)-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N=c2sc(=Cc3cc(C)n(-c4ccc(-c5ccc([N+](=O)[O-])cc5)cc4)c3C)c(=O)n2C1c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C36H31N5O7S/c1-6-48-35(43)32-22(4)37-36-39(33(32)26-8-7-20(2)30(18-26)41(46)47)34(42)31(49-36)19-27-17-21(3)38(23(27)5)28-13-9-24(10-14-28)25-11-15-29(16-12-25)40(44)45/h7-19,33H,6H2,1-5H3 |
| InChIKey | KGPBBDGTRNMROS-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 151.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.74 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|