C24H27F3N4OS2 — CID 126372575
N-[(6S)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-[[4-(trifluoromethyl)-5,6,7,8-tetrahydroquinazolin-2-yl]sulfanyl]acetamide (PubChem CID 126372575) has the molecular formula C24H27F3N4OS2 and a molecular weight of 508.64 g/mol. Its IUPAC name is N-[(6S)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-[[4-(trifluoromethyl)-5,6,7,8-tetrahydroquinazolin-2-yl]sulfanyl]acetamide.
| Compound Name | N-[(6S)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-[[4-(trifluoromethyl)-5,6,7,8-tetrahydroquinazolin-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 126372575 |
| Molecular Formula | C24H27F3N4OS2 |
| Molecular Weight | 508.64 g/mol |
| Exact Mass | 508.16 |
| IUPAC Name | N-[(6S)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-[[4-(trifluoromethyl)-5,6,7,8-tetrahydroquinazolin-2-yl]sulfanyl]acetamide |
| SMILES | CC(C)(C)[C@H]1CCc2c(sc(NC(=O)CSc3nc4c(c(C(F)(F)F)n3)CCCC4)c2C#N)C1 |
| InChI | InChI=1S/C24H27F3N4OS2/c1-23(2,3)13-8-9-14-16(11-28)21(34-18(14)10-13)30-19(32)12-33-22-29-17-7-5-4-6-15(17)20(31-22)24(25,26)27/h13H,4-10,12H2,1-3H3,(H,30,32)/t13-/m0/s1 |
| InChIKey | OHMVBNRJIAZTMB-ZDUSSCGKSA-N |
| XLogP | 6.19 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.64 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |