C21H23N5O2S2 — CID 2205538
N-[(6S)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-[[5-(furan-2-yl)-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 2205538) has the molecular formula C21H23N5O2S2 and a molecular weight of 441.58 g/mol. Its IUPAC name is N-[(6S)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-[[5-(furan-2-yl)-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-[(6S)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-[[5-(furan-2-yl)-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 2205538 |
| Molecular Formula | C21H23N5O2S2 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | N-[(6S)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-[[5-(furan-2-yl)-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CC(C)(C)[C@H]1CCc2c(sc(NC(=O)CSc3n[nH]c(-c4ccco4)n3)c2C#N)C1 |
| InChI | InChI=1S/C21H23N5O2S2/c1-21(2,3)12-6-7-13-14(10-22)19(30-16(13)9-12)23-17(27)11-29-20-24-18(25-26-20)15-5-4-8-28-15/h4-5,8,12H,6-7,9,11H2,1-3H3,(H,23,27)(H,24,25,26)/t12-/m0/s1 |
| InChIKey | LYBVEDYUDWEQDL-LBPRGKRZSA-N |
| XLogP | 4.88 |
| TPSA | 107.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |