C34H27N3O3S — CID 126385784
(5Z)-3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-5-[[1-(naphthalen-1-ylmethyl)indol-3-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 126385784) has the molecular formula C34H27N3O3S and a molecular weight of 557.68 g/mol. Its IUPAC name is (5Z)-3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-5-[[1-(naphthalen-1-ylmethyl)indol-3-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-5-[[1-(naphthalen-1-ylmethyl)indol-3-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126385784 |
| Molecular Formula | C34H27N3O3S |
| Molecular Weight | 557.68 g/mol |
| Exact Mass | 557.18 |
| IUPAC Name | (5Z)-3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-5-[[1-(naphthalen-1-ylmethyl)indol-3-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(CN1C(=O)S/C(=C\c2cn(Cc3cccc4ccccc34)c3ccccc23)C1=O)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C34H27N3O3S/c38-32(35-17-16-23-8-1-2-10-25(23)19-35)22-37-33(39)31(41-34(37)40)18-27-21-36(30-15-6-5-14-29(27)30)20-26-12-7-11-24-9-3-4-13-28(24)26/h1-15,18,21H,16-17,19-20,22H2/b31-18- |
| InChIKey | DPYQXJPNYHPEMM-MNBJERMJSA-N |
| XLogP | 6.46 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.68 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|