C25H16BrF4N3O3 — CID 126387887
(E)-3-[3-bromo-4-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]-2-cyano-N-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 126387887) has the molecular formula C25H16BrF4N3O3 and a molecular weight of 562.32 g/mol. Its IUPAC name is (E)-3-[3-bromo-4-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]-2-cyano-N-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-[3-bromo-4-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]-2-cyano-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 126387887 |
| Molecular Formula | C25H16BrF4N3O3 |
| Molecular Weight | 562.32 g/mol |
| Exact Mass | 561.03 |
| IUPAC Name | (E)-3-[3-bromo-4-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]-2-cyano-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | N#C/C(=C\c1ccc(OCC(=O)Nc2ccccc2F)c(Br)c1)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H16BrF4N3O3/c26-19-11-15(8-9-22(19)36-14-23(34)33-21-7-2-1-6-20(21)27)10-16(13-31)24(35)32-18-5-3-4-17(12-18)25(28,29)30/h1-12H,14H2,(H,32,35)(H,33,34)/b16-10+ |
| InChIKey | UFXZLKMVSCMMAU-MHWRWJLKSA-N |
| XLogP | 6.17 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.32 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|