C21H22NO3P — CID 1263885
4-[(S)-diphenylphosphoryl(furan-2-yl)methyl]morpholine (PubChem CID 1263885) has the molecular formula C21H22NO3P and a molecular weight of 367.38 g/mol. Its IUPAC name is 4-[(S)-diphenylphosphoryl(furan-2-yl)methyl]morpholine.
| Compound Name | 4-[(S)-diphenylphosphoryl(furan-2-yl)methyl]morpholine |
|---|---|
| PubChem CID | 1263885 |
| Molecular Formula | C21H22NO3P |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 4-[(S)-diphenylphosphoryl(furan-2-yl)methyl]morpholine |
| SMILES | O=P(c1ccccc1)(c1ccccc1)[C@@H](c1ccco1)N1CCOCC1 |
| InChI | InChI=1S/C21H22NO3P/c23-26(18-8-3-1-4-9-18,19-10-5-2-6-11-19)21(20-12-7-15-25-20)22-13-16-24-17-14-22/h1-12,15,21H,13-14,16-17H2/t21-/m0/s1 |
| InChIKey | GRTJLNVTZHJJFL-NRFANRHFSA-N |
| XLogP | 3.62 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|