C16H23NO5 — CID 126388548
(E)-N-(3-methoxypropyl)-3-(2,3,4-trimethoxyphenyl)prop-2-enamide (PubChem CID 126388548) has the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. Its IUPAC name is (E)-N-(3-methoxypropyl)-3-(2,3,4-trimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-(3-methoxypropyl)-3-(2,3,4-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126388548 |
| Molecular Formula | C16H23NO5 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | (E)-N-(3-methoxypropyl)-3-(2,3,4-trimethoxyphenyl)prop-2-enamide |
| SMILES | COCCCNC(=O)/C=C/c1ccc(OC)c(OC)c1OC |
| InChI | InChI=1S/C16H23NO5/c1-19-11-5-10-17-14(18)9-7-12-6-8-13(20-2)16(22-4)15(12)21-3/h6-9H,5,10-11H2,1-4H3,(H,17,18)/b9-7+ |
| InChIKey | SRUBJOJDORPLLR-VQHVLOKHSA-N |
| XLogP | 1.88 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|