C19H29NO4 — CID 6068482
(E)-N-(2,4-dimethylpentan-3-yl)-3-(2,3,4-trimethoxyphenyl)prop-2-enamide (PubChem CID 6068482) has the molecular formula C19H29NO4 and a molecular weight of 335.44 g/mol. Its IUPAC name is (E)-N-(2,4-dimethylpentan-3-yl)-3-(2,3,4-trimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-(2,4-dimethylpentan-3-yl)-3-(2,3,4-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 6068482 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | (E)-N-(2,4-dimethylpentan-3-yl)-3-(2,3,4-trimethoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)NC(C(C)C)C(C)C)c(OC)c1OC |
| InChI | InChI=1S/C19H29NO4/c1-12(2)17(13(3)4)20-16(21)11-9-14-8-10-15(22-5)19(24-7)18(14)23-6/h8-13,17H,1-7H3,(H,20,21)/b11-9+ |
| InChIKey | XFZQWNMWMLIHQY-PKNBQFBNSA-N |
| XLogP | 3.52 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|