C25H18ClN3OS2 — CID 126391000
2-[4-(4-chlorophenyl)-6-methylpyrimidin-2-yl]sulfanyl-1-phenothiazin-10-ylethanone (PubChem CID 126391000) has the molecular formula C25H18ClN3OS2 and a molecular weight of 476.03 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)-6-methylpyrimidin-2-yl]sulfanyl-1-phenothiazin-10-ylethanone.
| Compound Name | 2-[4-(4-chlorophenyl)-6-methylpyrimidin-2-yl]sulfanyl-1-phenothiazin-10-ylethanone |
|---|---|
| PubChem CID | 126391000 |
| Molecular Formula | C25H18ClN3OS2 |
| Molecular Weight | 476.03 g/mol |
| Exact Mass | 475.06 |
| IUPAC Name | 2-[4-(4-chlorophenyl)-6-methylpyrimidin-2-yl]sulfanyl-1-phenothiazin-10-ylethanone |
| SMILES | Cc1cc(-c2ccc(Cl)cc2)nc(SCC(=O)N2c3ccccc3Sc3ccccc32)n1 |
| InChI | InChI=1S/C25H18ClN3OS2/c1-16-14-19(17-10-12-18(26)13-11-17)28-25(27-16)31-15-24(30)29-20-6-2-4-8-22(20)32-23-9-5-3-7-21(23)29/h2-14H,15H2,1H3 |
| InChIKey | TXZNILPSLPDSBP-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.03 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |