C19H16N4OS2 — CID 40663175
2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-1-phenothiazin-10-ylethanone (PubChem CID 40663175) has the molecular formula C19H16N4OS2 and a molecular weight of 380.50 g/mol. Its IUPAC name is 2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-1-phenothiazin-10-ylethanone.
| Compound Name | 2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-1-phenothiazin-10-ylethanone |
|---|---|
| PubChem CID | 40663175 |
| Molecular Formula | C19H16N4OS2 |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-1-phenothiazin-10-ylethanone |
| SMILES | Cc1cc(N)nc(SCC(=O)N2c3ccccc3Sc3ccccc32)n1 |
| InChI | InChI=1S/C19H16N4OS2/c1-12-10-17(20)22-19(21-12)25-11-18(24)23-13-6-2-4-8-15(13)26-16-9-5-3-7-14(16)23/h2-10H,11H2,1H3,(H2,20,21,22) |
| InChIKey | VQWBOQBVGKOSDE-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |