C19H17N5OS2 — CID 23859692
2-(4,6-diaminopyrimidin-2-yl)sulfanyl-1-phenothiazin-10-ylpropan-1-one (PubChem CID 23859692) has the molecular formula C19H17N5OS2 and a molecular weight of 395.51 g/mol. Its IUPAC name is 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-1-phenothiazin-10-ylpropan-1-one.
| Compound Name | 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-1-phenothiazin-10-ylpropan-1-one |
|---|---|
| PubChem CID | 23859692 |
| Molecular Formula | C19H17N5OS2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-1-phenothiazin-10-ylpropan-1-one |
| SMILES | CC(Sc1nc(N)cc(N)n1)C(=O)N1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C19H17N5OS2/c1-11(26-19-22-16(20)10-17(21)23-19)18(25)24-12-6-2-4-8-14(12)27-15-9-5-3-7-13(15)24/h2-11H,1H3,(H4,20,21,22,23) |
| InChIKey | HGDOMSDFSRNVHT-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |