C19H14ClF3N2OS — CID 126391565
2-[(4-chlorophenyl)methylsulfanyl]-4-(4-methoxyphenyl)-6-(trifluoromethyl)pyrimidine (PubChem CID 126391565) has the molecular formula C19H14ClF3N2OS and a molecular weight of 410.85 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methylsulfanyl]-4-(4-methoxyphenyl)-6-(trifluoromethyl)pyrimidine.
| Compound Name | 2-[(4-chlorophenyl)methylsulfanyl]-4-(4-methoxyphenyl)-6-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 126391565 |
| Molecular Formula | C19H14ClF3N2OS |
| Molecular Weight | 410.85 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | 2-[(4-chlorophenyl)methylsulfanyl]-4-(4-methoxyphenyl)-6-(trifluoromethyl)pyrimidine |
| SMILES | COc1ccc(-c2cc(C(F)(F)F)nc(SCc3ccc(Cl)cc3)n2)cc1 |
| InChI | InChI=1S/C19H14ClF3N2OS/c1-26-15-8-4-13(5-9-15)16-10-17(19(21,22)23)25-18(24-16)27-11-12-2-6-14(20)7-3-12/h2-10H,11H2,1H3 |
| InChIKey | YRCCGGGRIUTDCY-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.85 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |