C18H11Cl2F3N2S — CID 126390833
4-(4-chlorophenyl)-2-[(2-chlorophenyl)methylsulfanyl]-6-(trifluoromethyl)pyrimidine (PubChem CID 126390833) has the molecular formula C18H11Cl2F3N2S and a molecular weight of 415.27 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2-[(2-chlorophenyl)methylsulfanyl]-6-(trifluoromethyl)pyrimidine.
| Compound Name | 4-(4-chlorophenyl)-2-[(2-chlorophenyl)methylsulfanyl]-6-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 126390833 |
| Molecular Formula | C18H11Cl2F3N2S |
| Molecular Weight | 415.27 g/mol |
| Exact Mass | 414.00 |
| IUPAC Name | 4-(4-chlorophenyl)-2-[(2-chlorophenyl)methylsulfanyl]-6-(trifluoromethyl)pyrimidine |
| SMILES | FC(F)(F)c1cc(-c2ccc(Cl)cc2)nc(SCc2ccccc2Cl)n1 |
| InChI | InChI=1S/C18H11Cl2F3N2S/c19-13-7-5-11(6-8-13)15-9-16(18(21,22)23)25-17(24-15)26-10-12-3-1-2-4-14(12)20/h1-9H,10H2 |
| InChIKey | RYAPAWGTWBRLTE-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.27 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |