C20H15F3N2O2S — CID 126389385
3-[[4-(4-methylphenyl)-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylmethyl]benzoic acid (PubChem CID 126389385) has the molecular formula C20H15F3N2O2S and a molecular weight of 404.41 g/mol. Its IUPAC name is 3-[[4-(4-methylphenyl)-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylmethyl]benzoic acid.
| Compound Name | 3-[[4-(4-methylphenyl)-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylmethyl]benzoic acid |
|---|---|
| PubChem CID | 126389385 |
| Molecular Formula | C20H15F3N2O2S |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 3-[[4-(4-methylphenyl)-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylmethyl]benzoic acid |
| SMILES | Cc1ccc(-c2cc(C(F)(F)F)nc(SCc3cccc(C(=O)O)c3)n2)cc1 |
| InChI | InChI=1S/C20H15F3N2O2S/c1-12-5-7-14(8-6-12)16-10-17(20(21,22)23)25-19(24-16)28-11-13-3-2-4-15(9-13)18(26)27/h2-10H,11H2,1H3,(H,26,27) |
| InChIKey | DRHLGEUBACLVPY-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |