C18H11ClF4N2OS — CID 42846132
4-(2-chlorophenoxy)-2-[(2-fluorophenyl)methylsulfanyl]-6-(trifluoromethyl)pyrimidine (PubChem CID 42846132) has the molecular formula C18H11ClF4N2OS and a molecular weight of 414.81 g/mol. Its IUPAC name is 4-(2-chlorophenoxy)-2-[(2-fluorophenyl)methylsulfanyl]-6-(trifluoromethyl)pyrimidine.
| Compound Name | 4-(2-chlorophenoxy)-2-[(2-fluorophenyl)methylsulfanyl]-6-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 42846132 |
| Molecular Formula | C18H11ClF4N2OS |
| Molecular Weight | 414.81 g/mol |
| Exact Mass | 414.02 |
| IUPAC Name | 4-(2-chlorophenoxy)-2-[(2-fluorophenyl)methylsulfanyl]-6-(trifluoromethyl)pyrimidine |
| SMILES | Fc1ccccc1CSc1nc(Oc2ccccc2Cl)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C18H11ClF4N2OS/c19-12-6-2-4-8-14(12)26-16-9-15(18(21,22)23)24-17(25-16)27-10-11-5-1-3-7-13(11)20/h1-9H,10H2 |
| InChIKey | UZLFQFKDXFSQPR-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.81 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |